C17H14F3N3O — CID 759754
5-(4-ethoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazole (PubChem CID 759754) has the molecular formula C17H14F3N3O and a molecular weight of 333.31 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazole.
| Compound Name | 5-(4-ethoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 759754 |
| Molecular Formula | C17H14F3N3O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 5-(4-ethoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazole |
| SMILES | CCOc1ccc(-c2ncnn2-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H14F3N3O/c1-2-24-15-8-6-12(7-9-15)16-21-11-22-23(16)14-5-3-4-13(10-14)17(18,19)20/h3-11H,2H2,1H3 |
| InChIKey | HRLNGNOAFKXKEX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |