C18H18N6 — CID 75992195
3-(1-azabicyclo[2.2.2]octan-3-ylamino)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile (PubChem CID 75992195) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-(1-azabicyclo[2.2.2]octan-3-ylamino)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile.
| Compound Name | 3-(1-azabicyclo[2.2.2]octan-3-ylamino)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 75992195 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-(1-azabicyclo[2.2.2]octan-3-ylamino)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1ncc2[nH]c3ncccc3c2c1NC1CN2CCC1CC2 |
| InChI | InChI=1S/C18H18N6/c19-8-13-17(22-15-10-24-6-3-11(15)4-7-24)16-12-2-1-5-20-18(12)23-14(16)9-21-13/h1-2,5,9,11,15,22H,3-4,6-7,10H2,(H,20,23) |
| InChIKey | JRELBJHZEAWGFO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |