C17H17N5O — CID 53251213
3-(4-hydroxy-4-methylpiperidin-1-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile (PubChem CID 53251213) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 3-(4-hydroxy-4-methylpiperidin-1-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile.
| Compound Name | 3-(4-hydroxy-4-methylpiperidin-1-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 53251213 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-(4-hydroxy-4-methylpiperidin-1-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
| SMILES | CC1(O)CCN(c2c(C#N)ncc3[nH]c4ncccc4c23)CC1 |
| InChI | InChI=1S/C17H17N5O/c1-17(23)4-7-22(8-5-17)15-12(9-18)20-10-13-14(15)11-3-2-6-19-16(11)21-13/h2-3,6,10,23H,4-5,7-8H2,1H3,(H,19,21) |
| InChIKey | BSTJHDJWYKFNNU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |