C18H19ClN6 — CID 58365141
12-chloro-3-[(1-ethylpiperidin-4-yl)amino]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile (PubChem CID 58365141) has the molecular formula C18H19ClN6 and a molecular weight of 354.85 g/mol. Its IUPAC name is 12-chloro-3-[(1-ethylpiperidin-4-yl)amino]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-chloro-3-[(1-ethylpiperidin-4-yl)amino]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58365141 |
| Molecular Formula | C18H19ClN6 |
| Molecular Weight | 354.85 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 12-chloro-3-[(1-ethylpiperidin-4-yl)amino]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
| SMILES | CCN1CCC(Nc2c(C#N)ncc3[nH]c4ncc(Cl)cc4c23)CC1 |
| InChI | InChI=1S/C18H19ClN6/c1-2-25-5-3-12(4-6-25)23-17-14(8-20)21-10-15-16(17)13-7-11(19)9-22-18(13)24-15/h7,9-10,12,23H,2-6H2,1H3,(H,22,24) |
| InChIKey | YAXXHLDEBQDJEZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.85 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |