C20H23BrN6 — CID 58266811
12-bromo-3-[4-(diethylamino)piperidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile (PubChem CID 58266811) has the molecular formula C20H23BrN6 and a molecular weight of 427.35 g/mol. Its IUPAC name is 12-bromo-3-[4-(diethylamino)piperidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-bromo-3-[4-(diethylamino)piperidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266811 |
| Molecular Formula | C20H23BrN6 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 12-bromo-3-[4-(diethylamino)piperidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
| SMILES | CCN(CC)C1CCN(c2c(C#N)ncc3[nH]c4ncc(Br)cc4c23)CC1 |
| InChI | InChI=1S/C20H23BrN6/c1-3-26(4-2)14-5-7-27(8-6-14)19-16(10-22)23-12-17-18(19)15-9-13(21)11-24-20(15)25-17/h9,11-12,14H,3-8H2,1-2H3,(H,24,25) |
| InChIKey | VAVICUCODRHEHI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |