C16H15N3O3S2 — CID 7599897
N'-(4-methyl-1,3-benzothiazol-2-yl)-3-methylsulfonylbenzohydrazide (PubChem CID 7599897) has the molecular formula C16H15N3O3S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is N'-(4-methyl-1,3-benzothiazol-2-yl)-3-methylsulfonylbenzohydrazide.
| Compound Name | N'-(4-methyl-1,3-benzothiazol-2-yl)-3-methylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 7599897 |
| Molecular Formula | C16H15N3O3S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | N'-(4-methyl-1,3-benzothiazol-2-yl)-3-methylsulfonylbenzohydrazide |
| SMILES | Cc1cccc2sc(NNC(=O)c3cccc(S(C)(=O)=O)c3)nc12 |
| InChI | InChI=1S/C16H15N3O3S2/c1-10-5-3-8-13-14(10)17-16(23-13)19-18-15(20)11-6-4-7-12(9-11)24(2,21)22/h3-9H,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | UFVPTBLARBWGKH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|