C17H16ClN3OS — CID 7600199
N'-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-2,5-dimethylbenzohydrazide (PubChem CID 7600199) has the molecular formula C17H16ClN3OS and a molecular weight of 345.86 g/mol. Its IUPAC name is N'-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-2,5-dimethylbenzohydrazide.
| Compound Name | N'-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-2,5-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 7600199 |
| Molecular Formula | C17H16ClN3OS |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N'-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-2,5-dimethylbenzohydrazide |
| SMILES | Cc1ccc(C)c(C(=O)NNc2nc3c(C)ccc(Cl)c3s2)c1 |
| InChI | InChI=1S/C17H16ClN3OS/c1-9-4-5-10(2)12(8-9)16(22)20-21-17-19-14-11(3)6-7-13(18)15(14)23-17/h4-8H,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | GKRZRJAROFBVQC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|