C16H13Cl2N3OS — CID 7600050
N'-(4,7-dichloro-1,3-benzothiazol-2-yl)-2,5-dimethylbenzohydrazide (PubChem CID 7600050) has the molecular formula C16H13Cl2N3OS and a molecular weight of 366.27 g/mol. Its IUPAC name is N'-(4,7-dichloro-1,3-benzothiazol-2-yl)-2,5-dimethylbenzohydrazide.
| Compound Name | N'-(4,7-dichloro-1,3-benzothiazol-2-yl)-2,5-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 7600050 |
| Molecular Formula | C16H13Cl2N3OS |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N'-(4,7-dichloro-1,3-benzothiazol-2-yl)-2,5-dimethylbenzohydrazide |
| SMILES | Cc1ccc(C)c(C(=O)NNc2nc3c(Cl)ccc(Cl)c3s2)c1 |
| InChI | InChI=1S/C16H13Cl2N3OS/c1-8-3-4-9(2)10(7-8)15(22)20-21-16-19-13-11(17)5-6-12(18)14(13)23-16/h3-7H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | ZKWFJKXRJSIZQO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|