C18H29N5O3S2 — CID 7606740
[2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 7606740) has the molecular formula C18H29N5O3S2 and a molecular weight of 427.60 g/mol. Its IUPAC name is [2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7606740 |
| Molecular Formula | C18H29N5O3S2 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | [2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | CCCCN(C(=O)CSC(=S)N1CCCC1)c1c(N)n(CCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H29N5O3S2/c1-3-5-11-22(13(24)12-28-18(27)21-9-6-7-10-21)14-15(19)23(8-4-2)17(26)20-16(14)25/h3-12,19H2,1-2H3,(H,20,25,26) |
| InChIKey | NLXLLMMICPTWOK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|