C21H26N2O3S — CID 7614600
N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-3,3-diphenylpropanehydrazide (PubChem CID 7614600) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-3,3-diphenylpropanehydrazide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-3,3-diphenylpropanehydrazide |
|---|---|
| PubChem CID | 7614600 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-3,3-diphenylpropanehydrazide |
| SMILES | CN(C)N(C(=O)CC(c1ccccc1)c1ccccc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H26N2O3S/c1-22(2)23(19-13-14-27(25,26)16-19)21(24)15-20(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | IMRUTJIMXLNRSS-IBGZPJMESA-N |
| XLogP | 2.70 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|