C13H17N3O3 — CID 7615867
1,1-bis(2-hydroxyethyl)-3-(1H-indol-3-yl)urea (PubChem CID 7615867) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1,1-bis(2-hydroxyethyl)-3-(1H-indol-3-yl)urea.
| Compound Name | 1,1-bis(2-hydroxyethyl)-3-(1H-indol-3-yl)urea |
|---|---|
| PubChem CID | 7615867 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1,1-bis(2-hydroxyethyl)-3-(1H-indol-3-yl)urea |
| SMILES | O=C(Nc1c[nH]c2ccccc12)N(CCO)CCO |
| InChI | InChI=1S/C13H17N3O3/c17-7-5-16(6-8-18)13(19)15-12-9-14-11-4-2-1-3-10(11)12/h1-4,9,14,17-18H,5-8H2,(H,15,19) |
| InChIKey | PUPULYIPTMCOJP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |