C15H21N4O2+ — CID 7615912
4-(2-hydroxyethyl)-N-(1H-indol-3-yl)piperazin-4-ium-1-carboxamide (PubChem CID 7615912) has the molecular formula C15H21N4O2+ and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-N-(1H-indol-3-yl)piperazin-4-ium-1-carboxamide.
| Compound Name | 4-(2-hydroxyethyl)-N-(1H-indol-3-yl)piperazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 7615912 |
| Molecular Formula | C15H21N4O2+ |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 4-(2-hydroxyethyl)-N-(1H-indol-3-yl)piperazin-4-ium-1-carboxamide |
| SMILES | O=C(Nc1c[nH]c2ccccc12)N1CC[NH+](CCO)CC1 |
| InChI | InChI=1S/C15H20N4O2/c20-10-9-18-5-7-19(8-6-18)15(21)17-14-11-16-13-4-2-1-3-12(13)14/h1-4,11,16,20H,5-10H2,(H,17,21)/p+1 |
| InChIKey | PGXFALBUTXWLHQ-UHFFFAOYSA-O |
| XLogP | -0.11 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |