C18H19FN2O5 — CID 7616551
ethyl 4-(2-fluorophenyl)-5-[2-(2-hydroxyethylamino)-2-oxoacetyl]-2-methyl-1H-pyrrole-3-carboxylate (PubChem CID 7616551) has the molecular formula C18H19FN2O5 and a molecular weight of 362.36 g/mol. Its IUPAC name is ethyl 4-(2-fluorophenyl)-5-[2-(2-hydroxyethylamino)-2-oxoacetyl]-2-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-(2-fluorophenyl)-5-[2-(2-hydroxyethylamino)-2-oxoacetyl]-2-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7616551 |
| Molecular Formula | C18H19FN2O5 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | ethyl 4-(2-fluorophenyl)-5-[2-(2-hydroxyethylamino)-2-oxoacetyl]-2-methyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)C(=O)NCCO)c1-c1ccccc1F |
| InChI | InChI=1S/C18H19FN2O5/c1-3-26-18(25)13-10(2)21-15(16(23)17(24)20-8-9-22)14(13)11-6-4-5-7-12(11)19/h4-7,21-22H,3,8-9H2,1-2H3,(H,20,24) |
| InChIKey | DOJANHKFRSDWNH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|