C21H25FN2O5 — CID 7616562
ethyl 5-[2-(3-ethoxypropylamino)-2-oxoacetyl]-4-(2-fluorophenyl)-2-methyl-1H-pyrrole-3-carboxylate (PubChem CID 7616562) has the molecular formula C21H25FN2O5 and a molecular weight of 404.44 g/mol. Its IUPAC name is ethyl 5-[2-(3-ethoxypropylamino)-2-oxoacetyl]-4-(2-fluorophenyl)-2-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[2-(3-ethoxypropylamino)-2-oxoacetyl]-4-(2-fluorophenyl)-2-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7616562 |
| Molecular Formula | C21H25FN2O5 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | ethyl 5-[2-(3-ethoxypropylamino)-2-oxoacetyl]-4-(2-fluorophenyl)-2-methyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOCCCNC(=O)C(=O)c1[nH]c(C)c(C(=O)OCC)c1-c1ccccc1F |
| InChI | InChI=1S/C21H25FN2O5/c1-4-28-12-8-11-23-20(26)19(25)18-17(14-9-6-7-10-15(14)22)16(13(3)24-18)21(27)29-5-2/h6-7,9-10,24H,4-5,8,11-12H2,1-3H3,(H,23,26) |
| InChIKey | GNXSETYVXWJSSW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|