C21H26N2O6 — CID 7616703
ethyl 4-(2,5-dimethoxyphenyl)-2-methyl-5-[2-oxo-2-(propylamino)acetyl]-1H-pyrrole-3-carboxylate (PubChem CID 7616703) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is ethyl 4-(2,5-dimethoxyphenyl)-2-methyl-5-[2-oxo-2-(propylamino)acetyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-(2,5-dimethoxyphenyl)-2-methyl-5-[2-oxo-2-(propylamino)acetyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7616703 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | ethyl 4-(2,5-dimethoxyphenyl)-2-methyl-5-[2-oxo-2-(propylamino)acetyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCCNC(=O)C(=O)c1[nH]c(C)c(C(=O)OCC)c1-c1cc(OC)ccc1OC |
| InChI | InChI=1S/C21H26N2O6/c1-6-10-22-20(25)19(24)18-17(16(12(3)23-18)21(26)29-7-2)14-11-13(27-4)8-9-15(14)28-5/h8-9,11,23H,6-7,10H2,1-5H3,(H,22,25) |
| InChIKey | PGKOEOYIAPOFCA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|