C23H30N2O5 — CID 7616620
ethyl 5-[2-[butyl(ethyl)amino]-2-oxoacetyl]-4-(4-methoxyphenyl)-2-methyl-1H-pyrrole-3-carboxylate (PubChem CID 7616620) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is ethyl 5-[2-[butyl(ethyl)amino]-2-oxoacetyl]-4-(4-methoxyphenyl)-2-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[2-[butyl(ethyl)amino]-2-oxoacetyl]-4-(4-methoxyphenyl)-2-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7616620 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | ethyl 5-[2-[butyl(ethyl)amino]-2-oxoacetyl]-4-(4-methoxyphenyl)-2-methyl-1H-pyrrole-3-carboxylate |
| SMILES | CCCCN(CC)C(=O)C(=O)c1[nH]c(C)c(C(=O)OCC)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H30N2O5/c1-6-9-14-25(7-2)22(27)21(26)20-19(16-10-12-17(29-5)13-11-16)18(15(4)24-20)23(28)30-8-3/h10-13,24H,6-9,14H2,1-5H3 |
| InChIKey | UVODIXFLTQTKFG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|