C24H43N2O2+ — CID 7619078
3-[[(3R)-4-methyl-3-(4-propan-2-yloxyphenyl)pentanoyl]amino]propyl-dipropylazanium (PubChem CID 7619078) has the molecular formula C24H43N2O2+ and a molecular weight of 391.62 g/mol. Its IUPAC name is 3-[[(3R)-4-methyl-3-(4-propan-2-yloxyphenyl)pentanoyl]amino]propyl-dipropylazanium.
| Compound Name | 3-[[(3R)-4-methyl-3-(4-propan-2-yloxyphenyl)pentanoyl]amino]propyl-dipropylazanium |
|---|---|
| PubChem CID | 7619078 |
| Molecular Formula | C24H43N2O2+ |
| Molecular Weight | 391.62 g/mol |
| Exact Mass | 391.33 |
| IUPAC Name | 3-[[(3R)-4-methyl-3-(4-propan-2-yloxyphenyl)pentanoyl]amino]propyl-dipropylazanium |
| SMILES | CCC[NH+](CCC)CCCNC(=O)C[C@@H](c1ccc(OC(C)C)cc1)C(C)C |
| InChI | InChI=1S/C24H42N2O2/c1-7-15-26(16-8-2)17-9-14-25-24(27)18-23(19(3)4)21-10-12-22(13-11-21)28-20(5)6/h10-13,19-20,23H,7-9,14-18H2,1-6H3,(H,25,27)/p+1/t23-/m1/s1 |
| InChIKey | XBIFVFLSCUABKM-HSZRJFAPSA-O |
| XLogP | 3.81 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|