C20H26N8S — CID 7631440
6-[(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 7631440) has the molecular formula C20H26N8S and a molecular weight of 410.55 g/mol. Its IUPAC name is 6-[(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 7631440 |
| Molecular Formula | C20H26N8S |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 6-[(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(N)nc(CSc3nnc(C)n3C3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C20H26N8S/c1-13-8-10-15(11-9-13)22-19-24-17(23-18(21)25-19)12-29-20-27-26-14(2)28(20)16-6-4-3-5-7-16/h8-11,16H,3-7,12H2,1-2H3,(H3,21,22,23,24,25) |
| InChIKey | WDLOSKLPRGYKFS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |