C14H21N3O5S — CID 7632200
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 7632200) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 7632200 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | O=C(COC(=O)CN1CCSC1=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H21N3O5S/c18-11(16-13(20)15-10-4-2-1-3-5-10)9-22-12(19)8-17-6-7-23-14(17)21/h10H,1-9H2,(H2,15,16,18,20) |
| InChIKey | NNIOXLQTTALXSK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|