C23H22FNO4 — CID 7632213
4-[[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylazaniumyl]methyl]benzoate (PubChem CID 7632213) has the molecular formula C23H22FNO4 and a molecular weight of 395.43 g/mol. Its IUPAC name is 4-[[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylazaniumyl]methyl]benzoate.
| Compound Name | 4-[[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylazaniumyl]methyl]benzoate |
|---|---|
| PubChem CID | 7632213 |
| Molecular Formula | C23H22FNO4 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-[[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylazaniumyl]methyl]benzoate |
| SMILES | COc1cc(C[NH2+]Cc2ccc(C(=O)[O-])cc2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H22FNO4/c1-28-22-12-18(14-25-13-16-2-7-19(8-3-16)23(26)27)6-11-21(22)29-15-17-4-9-20(24)10-5-17/h2-12,25H,13-15H2,1H3,(H,26,27) |
| InChIKey | DQCZGSNHRDHJRX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |