C14H16Cl3N3O3 — CID 7633938
[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 7633938) has the molecular formula C14H16Cl3N3O3 and a molecular weight of 380.66 g/mol. Its IUPAC name is [2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | [2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 7633938 |
| Molecular Formula | C14H16Cl3N3O3 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | [2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | C[C@H]1CCCN(C(=O)COC(=O)c2nc(Cl)c(Cl)c(N)c2Cl)C1 |
| InChI | InChI=1S/C14H16Cl3N3O3/c1-7-3-2-4-20(5-7)8(21)6-23-14(22)12-9(15)11(18)10(16)13(17)19-12/h7H,2-6H2,1H3,(H2,18,19)/t7-/m0/s1 |
| InChIKey | GIFZDDBEMMMPHD-ZETCQYMHSA-N |
| XLogP | 3.04 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|