C22H27N2O3+ — CID 7639723
(1R)-6-ethyl-1-(3,4,5-trimethoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium (PubChem CID 7639723) has the molecular formula C22H27N2O3+ and a molecular weight of 367.47 g/mol. Its IUPAC name is (1R)-6-ethyl-1-(3,4,5-trimethoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium.
| Compound Name | (1R)-6-ethyl-1-(3,4,5-trimethoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 7639723 |
| Molecular Formula | C22H27N2O3+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (1R)-6-ethyl-1-(3,4,5-trimethoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
| SMILES | CCc1ccc2[nH]c3c(c2c1)CC[NH2+][C@@H]3c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-5-13-6-7-17-16(10-13)15-8-9-23-20(21(15)24-17)14-11-18(25-2)22(27-4)19(12-14)26-3/h6-7,10-12,20,23-24H,5,8-9H2,1-4H3/p+1/t20-/m1/s1 |
| InChIKey | WIYBJWNXYVNYRM-HXUWFJFHSA-O |
| XLogP | 2.96 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|