C22H24N3O3+ — CID 7641029
(5S)-4-amino-5-(2-methoxyphenyl)-3-(2-methylpropyl)-5H-chromeno[2,3-d]pyrimidin-3-ium-8-ol (PubChem CID 7641029) has the molecular formula C22H24N3O3+ and a molecular weight of 378.45 g/mol. Its IUPAC name is (5S)-4-amino-5-(2-methoxyphenyl)-3-(2-methylpropyl)-5H-chromeno[2,3-d]pyrimidin-3-ium-8-ol.
| Compound Name | (5S)-4-amino-5-(2-methoxyphenyl)-3-(2-methylpropyl)-5H-chromeno[2,3-d]pyrimidin-3-ium-8-ol |
|---|---|
| PubChem CID | 7641029 |
| Molecular Formula | C22H24N3O3+ |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (5S)-4-amino-5-(2-methoxyphenyl)-3-(2-methylpropyl)-5H-chromeno[2,3-d]pyrimidin-3-ium-8-ol |
| SMILES | COc1ccccc1[C@H]1c2ccc(O)cc2Oc2nc[n+](CC(C)C)c(N)c21 |
| InChI | InChI=1S/C22H23N3O3/c1-13(2)11-25-12-24-22-20(21(25)23)19(15-6-4-5-7-17(15)27-3)16-9-8-14(26)10-18(16)28-22/h4-10,12-13,19,23,26H,11H2,1-3H3/p+1/t19-/m0/s1 |
| InChIKey | CFWJBMJEVIKGKU-IBGZPJMESA-O |
| XLogP | 3.61 |
| TPSA | 81.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|