C21H23N4O4+ — CID 7642031
(5S)-4-amino-5-(furan-2-yl)-3-(2-morpholin-4-ylethyl)-5H-chromeno[2,3-d]pyrimidin-3-ium-8-ol (PubChem CID 7642031) has the molecular formula C21H23N4O4+ and a molecular weight of 395.44 g/mol. Its IUPAC name is (5S)-4-amino-5-(furan-2-yl)-3-(2-morpholin-4-ylethyl)-5H-chromeno[2,3-d]pyrimidin-3-ium-8-ol.
| Compound Name | (5S)-4-amino-5-(furan-2-yl)-3-(2-morpholin-4-ylethyl)-5H-chromeno[2,3-d]pyrimidin-3-ium-8-ol |
|---|---|
| PubChem CID | 7642031 |
| Molecular Formula | C21H23N4O4+ |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (5S)-4-amino-5-(furan-2-yl)-3-(2-morpholin-4-ylethyl)-5H-chromeno[2,3-d]pyrimidin-3-ium-8-ol |
| SMILES | Nc1c2c(nc[n+]1CCN1CCOCC1)Oc1cc(O)ccc1[C@@H]2c1ccco1 |
| InChI | InChI=1S/C21H22N4O4/c22-20-19-18(16-2-1-9-28-16)15-4-3-14(26)12-17(15)29-21(19)23-13-25(20)6-5-24-7-10-27-11-8-24/h1-4,9,12-13,18,22,26H,5-8,10-11H2/p+1/t18-/m1/s1 |
| InChIKey | VFYOGXCOZKNEPM-GOSISDBHSA-O |
| XLogP | 1.87 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|