C19H23ClN3O5+ — CID 7642189
(1R,3R,3aR,6aS)-5'-chloro-1-[(1R)-1-hydroxyethyl]-5-(2-methoxyethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione (PubChem CID 7642189) has the molecular formula C19H23ClN3O5+ and a molecular weight of 408.86 g/mol. Its IUPAC name is (1R,3R,3aR,6aS)-5'-chloro-1-[(1R)-1-hydroxyethyl]-5-(2-methoxyethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3R,3aR,6aS)-5'-chloro-1-[(1R)-1-hydroxyethyl]-5-(2-methoxyethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 7642189 |
| Molecular Formula | C19H23ClN3O5+ |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (1R,3R,3aR,6aS)-5'-chloro-1-[(1R)-1-hydroxyethyl]-5-(2-methoxyethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
| SMILES | COCCN1C(=O)[C@@H]2[C@H]([C@@H](C)O)[NH2+][C@]3(C(=O)Nc4c(C)cc(Cl)cc43)[C@@H]2C1=O |
| InChI | InChI=1S/C19H22ClN3O5/c1-8-6-10(20)7-11-14(8)21-18(27)19(11)13-12(15(22-19)9(2)24)16(25)23(17(13)26)4-5-28-3/h6-7,9,12-13,15,22,24H,4-5H2,1-3H3,(H,21,27)/p+1/t9-,12+,13+,15+,19+/m1/s1 |
| InChIKey | ZIKUXWQTHPHBQZ-MGYNZIJRSA-O |
| XLogP | -0.63 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|