C17H19ClN3O4+ — CID 7642322
(1R,3S,3aR,6aS)-7'-chloro-5-(2-methoxyethyl)-1-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione (PubChem CID 7642322) has the molecular formula C17H19ClN3O4+ and a molecular weight of 364.81 g/mol. Its IUPAC name is (1R,3S,3aR,6aS)-7'-chloro-5-(2-methoxyethyl)-1-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aR,6aS)-7'-chloro-5-(2-methoxyethyl)-1-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 7642322 |
| Molecular Formula | C17H19ClN3O4+ |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (1R,3S,3aR,6aS)-7'-chloro-5-(2-methoxyethyl)-1-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
| SMILES | COCCN1C(=O)[C@H]2[C@@H](C1=O)[C@@]1([NH2+][C@@H]2C)C(=O)Nc2c(Cl)cccc21 |
| InChI | InChI=1S/C17H18ClN3O4/c1-8-11-12(15(23)21(14(11)22)6-7-25-2)17(20-8)9-4-3-5-10(18)13(9)19-16(17)24/h3-5,8,11-12,20H,6-7H2,1-2H3,(H,19,24)/p+1/t8-,11-,12+,17-/m1/s1 |
| InChIKey | UNCYZNYUKMRATD-JVRKEXCCSA-O |
| XLogP | -0.30 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|