C19H21ClN3O4+ — CID 7710933
(1S,3S,3aS,6aR)-7'-chloro-1-methyl-5-[[(2R)-oxolan-2-yl]methyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione (PubChem CID 7710933) has the molecular formula C19H21ClN3O4+ and a molecular weight of 390.85 g/mol. Its IUPAC name is (1S,3S,3aS,6aR)-7'-chloro-1-methyl-5-[[(2R)-oxolan-2-yl]methyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1S,3S,3aS,6aR)-7'-chloro-1-methyl-5-[[(2R)-oxolan-2-yl]methyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 7710933 |
| Molecular Formula | C19H21ClN3O4+ |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (1S,3S,3aS,6aR)-7'-chloro-1-methyl-5-[[(2R)-oxolan-2-yl]methyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
| SMILES | C[C@@H]1[NH2+][C@@]2(C(=O)Nc3c(Cl)cccc32)[C@H]2C(=O)N(C[C@H]3CCCO3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C19H20ClN3O4/c1-9-13-14(17(25)23(16(13)24)8-10-4-3-7-27-10)19(22-9)11-5-2-6-12(20)15(11)21-18(19)26/h2,5-6,9-10,13-14,22H,3-4,7-8H2,1H3,(H,21,26)/p+1/t9-,10+,13-,14+,19+/m0/s1 |
| InChIKey | NGWDVTPGGBGMOM-YJHBLDAOSA-O |
| XLogP | 0.23 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|