C20H26N3O3+ — CID 11921350
(1S,3R,3aR,6aS)-5-butyl-1,6',7'-trimethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione (PubChem CID 11921350) has the molecular formula C20H26N3O3+ and a molecular weight of 356.45 g/mol. Its IUPAC name is (1S,3R,3aR,6aS)-5-butyl-1,6',7'-trimethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1S,3R,3aR,6aS)-5-butyl-1,6',7'-trimethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 11921350 |
| Molecular Formula | C20H26N3O3+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (1S,3R,3aR,6aS)-5-butyl-1,6',7'-trimethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CCCCN1C(=O)[C@@H]2[C@H](C)[NH2+][C@]3(C(=O)Nc4c3ccc(C)c4C)[C@@H]2C1=O |
| InChI | InChI=1S/C20H25N3O3/c1-5-6-9-23-17(24)14-12(4)22-20(15(14)18(23)25)13-8-7-10(2)11(3)16(13)21-19(20)26/h7-8,12,14-15,22H,5-6,9H2,1-4H3,(H,21,26)/p+1/t12-,14+,15-,20-/m0/s1 |
| InChIKey | LJLIHYGJICFFQT-IRHLFGLPSA-O |
| XLogP | 0.82 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|