C18H21ClN3O4+ — CID 7640745
(1R,3R,3aR,6aS)-7'-chloro-5-(3-methoxypropyl)-1-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione (PubChem CID 7640745) has the molecular formula C18H21ClN3O4+ and a molecular weight of 378.84 g/mol. Its IUPAC name is (1R,3R,3aR,6aS)-7'-chloro-5-(3-methoxypropyl)-1-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3R,3aR,6aS)-7'-chloro-5-(3-methoxypropyl)-1-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 7640745 |
| Molecular Formula | C18H21ClN3O4+ |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (1R,3R,3aR,6aS)-7'-chloro-5-(3-methoxypropyl)-1-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
| SMILES | COCCCN1C(=O)[C@H]2[C@@H](C1=O)[C@]1([NH2+][C@@H]2C)C(=O)Nc2c(Cl)cccc21 |
| InChI | InChI=1S/C18H20ClN3O4/c1-9-12-13(16(24)22(15(12)23)7-4-8-26-2)18(21-9)10-5-3-6-11(19)14(10)20-17(18)25/h3,5-6,9,12-13,21H,4,7-8H2,1-2H3,(H,20,25)/p+1/t9-,12-,13+,18+/m1/s1 |
| InChIKey | KTHFOQVMKSESOB-DKGOEBOQSA-O |
| XLogP | 0.09 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|