C15H20N2O5 — CID 7646991
N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-(furan-2-ylmethyl)oxamide (PubChem CID 7646991) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-(furan-2-ylmethyl)oxamide.
| Compound Name | N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 7646991 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-(furan-2-ylmethyl)oxamide |
| SMILES | O=C(NCc1ccco1)C(=O)NC[C@H]1COC2(CCCC2)O1 |
| InChI | InChI=1S/C15H20N2O5/c18-13(16-8-11-4-3-7-20-11)14(19)17-9-12-10-21-15(22-12)5-1-2-6-15/h3-4,7,12H,1-2,5-6,8-10H2,(H,16,18)(H,17,19)/t12-/m0/s1 |
| InChIKey | ASLLAMMPILDYKC-LBPRGKRZSA-N |
| XLogP | 0.70 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|