C16H14Cl2N4O5 — CID 7650704
[(2R)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(methylamino)-3-nitrobenzoate (PubChem CID 7650704) has the molecular formula C16H14Cl2N4O5 and a molecular weight of 413.22 g/mol. Its IUPAC name is [(2R)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(methylamino)-3-nitrobenzoate.
| Compound Name | [(2R)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(methylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7650704 |
| Molecular Formula | C16H14Cl2N4O5 |
| Molecular Weight | 413.22 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | [(2R)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(methylamino)-3-nitrobenzoate |
| SMILES | CNc1ccc(C(=O)O[C@H](C)C(=O)Nc2ncc(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14Cl2N4O5/c1-8(15(23)21-14-11(18)6-10(17)7-20-14)27-16(24)9-3-4-12(19-2)13(5-9)22(25)26/h3-8,19H,1-2H3,(H,20,21,23)/t8-/m1/s1 |
| InChIKey | ZJTIRESNCYAFQB-MRVPVSSYSA-N |
| XLogP | 3.52 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|