C30H40O5 — CID 76511396
17-(2-carboxyethyl)-1,3,12,17-tetramethyl-16-prop-1-en-2-yl-6-oxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-5(9),7,13-triene-8-carboxylic acid (PubChem CID 76511396) has the molecular formula C30H40O5 and a molecular weight of 480.65 g/mol. Its IUPAC name is 17-(2-carboxyethyl)-1,3,12,17-tetramethyl-16-prop-1-en-2-yl-6-oxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-5(9),7,13-triene-8-carboxylic acid.
| Compound Name | 17-(2-carboxyethyl)-1,3,12,17-tetramethyl-16-prop-1-en-2-yl-6-oxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-5(9),7,13-triene-8-carboxylic acid |
|---|---|
| PubChem CID | 76511396 |
| Molecular Formula | C30H40O5 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | 17-(2-carboxyethyl)-1,3,12,17-tetramethyl-16-prop-1-en-2-yl-6-oxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-5(9),7,13-triene-8-carboxylic acid |
| SMILES | C=C(C)C1CC=C2C(CCC3(C)C4C(C)Cc5occ(C(=O)O)c5C4CC23C)C1(C)CCC(=O)O |
| InChI | InChI=1S/C30H40O5/c1-16(2)20-7-8-22-21(28(20,4)11-10-24(31)32)9-12-29(5)26-17(3)13-23-25(18(26)14-30(22,29)6)19(15-35-23)27(33)34/h8,15,17-18,20-21,26H,1,7,9-14H2,2-6H3,(H,31,32)(H,33,34) |
| InChIKey | XEVDYOAZVPAGTF-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|