C35H26O10 — CID 76514548
7,13-bis(2,4-dihydroxyphenyl)-3,17-dihydroxy-23-methyl-8,12,14-trioxahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-2(11),3,6,9,15(20),16,18,23-octaen-5-one (PubChem CID 76514548) has the molecular formula C35H26O10 and a molecular weight of 606.58 g/mol. Its IUPAC name is 7,13-bis(2,4-dihydroxyphenyl)-3,17-dihydroxy-23-methyl-8,12,14-trioxahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-2(11),3,6,9,15(20),16,18,23-octaen-5-one.
| Compound Name | 7,13-bis(2,4-dihydroxyphenyl)-3,17-dihydroxy-23-methyl-8,12,14-trioxahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-2(11),3,6,9,15(20),16,18,23-octaen-5-one |
|---|---|
| PubChem CID | 76514548 |
| Molecular Formula | C35H26O10 |
| Molecular Weight | 606.58 g/mol |
| Exact Mass | 606.15 |
| IUPAC Name | 7,13-bis(2,4-dihydroxyphenyl)-3,17-dihydroxy-23-methyl-8,12,14-trioxahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-2(11),3,6,9,15(20),16,18,23-octaen-5-one |
| SMILES | CC1=CC2c3c(cc4oc(-c5ccc(O)cc5O)cc(=O)c4c3O)OC3(c4ccc(O)cc4O)Oc4cc(O)ccc4C(C1)C23 |
| InChI | InChI=1S/C35H26O10/c1-15-8-21-19-5-2-18(38)12-28(19)44-35(23-7-4-17(37)11-25(23)40)33(21)22(9-15)31-30(45-35)14-29-32(34(31)42)26(41)13-27(43-29)20-6-3-16(36)10-24(20)39/h2-7,9-14,21-22,33,36-40,42H,8H2,1H3 |
| InChIKey | GSUHFFCDHMQSLR-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 170.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.58 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|