C25H26O6 — CID 162909791
2-[(2S,2aS,8bS)-6-hydroxy-1,1,2,3,3-pentamethyl-2a,8b-dihydro-2H-cyclobuta[c]chromen-7-yl]-5,7-dihydroxychromen-4-one (PubChem CID 162909791) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[(2S,2aS,8bS)-6-hydroxy-1,1,2,3,3-pentamethyl-2a,8b-dihydro-2H-cyclobuta[c]chromen-7-yl]-5,7-dihydroxychromen-4-one.
| Compound Name | 2-[(2S,2aS,8bS)-6-hydroxy-1,1,2,3,3-pentamethyl-2a,8b-dihydro-2H-cyclobuta[c]chromen-7-yl]-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 162909791 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-[(2S,2aS,8bS)-6-hydroxy-1,1,2,3,3-pentamethyl-2a,8b-dihydro-2H-cyclobuta[c]chromen-7-yl]-5,7-dihydroxychromen-4-one |
| SMILES | C[C@H]1[C@H]2[C@H](c3cc(-c4cc(=O)c5c(O)cc(O)cc5o4)c(O)cc3OC2(C)C)C1(C)C |
| InChI | InChI=1S/C25H26O6/c1-11-22-23(24(11,2)3)14-8-13(15(27)9-19(14)31-25(22,4)5)18-10-17(29)21-16(28)6-12(26)7-20(21)30-18/h6-11,22-23,26-28H,1-5H3/t11-,22-,23-/m0/s1 |
| InChIKey | WOEBDCLYNHDBHY-JHWMDXGOSA-N |
| XLogP | 5.12 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |