C34H28O7 — CID 162852382
4-[(E)-2-[(1S,9R,13R,21R)-1-(2,4-dihydroxyphenyl)-17-hydroxy-11-methyl-2,20-dioxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,10,14(19),15,17-heptaen-5-yl]ethenyl]benzene-1,3-diol (PubChem CID 162852382) has the molecular formula C34H28O7 and a molecular weight of 548.59 g/mol. Its IUPAC name is 4-[(E)-2-[(1S,9R,13R,21R)-1-(2,4-dihydroxyphenyl)-17-hydroxy-11-methyl-2,20-dioxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,10,14(19),15,17-heptaen-5-yl]ethenyl]benzene-1,3-diol.
| Compound Name | 4-[(E)-2-[(1S,9R,13R,21R)-1-(2,4-dihydroxyphenyl)-17-hydroxy-11-methyl-2,20-dioxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,10,14(19),15,17-heptaen-5-yl]ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 162852382 |
| Molecular Formula | C34H28O7 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 4-[(E)-2-[(1S,9R,13R,21R)-1-(2,4-dihydroxyphenyl)-17-hydroxy-11-methyl-2,20-dioxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,10,14(19),15,17-heptaen-5-yl]ethenyl]benzene-1,3-diol |
| SMILES | CC1=C[C@H]2c3ccc(/C=C/c4ccc(O)cc4O)cc3O[C@]3(c4ccc(O)cc4O)Oc4cc(O)ccc4[C@H](C1)[C@H]23 |
| InChI | InChI=1S/C34H28O7/c1-18-12-26-24-9-3-19(2-4-20-5-6-21(35)15-29(20)38)14-31(24)40-34(28-11-8-22(36)16-30(28)39)33(26)27(13-18)25-10-7-23(37)17-32(25)41-34/h2-12,14-17,26-27,33,35-39H,13H2,1H3/b4-2+/t26-,27-,33-,34+/m0/s1 |
| InChIKey | LTSRSDARASWSQF-STFKTIASSA-N |
| XLogP | 6.86 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|