C28H36O6 — CID 76525141
3',13-dihydroxy-4',5',5',10,14,16-hexamethylspiro[18-oxapentacyclo[13.3.2.01,14.02,11.05,10]icosa-2,5,11-triene-17,2'-oxolane]-4,7-dione (PubChem CID 76525141) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is 3',13-dihydroxy-4',5',5',10,14,16-hexamethylspiro[18-oxapentacyclo[13.3.2.01,14.02,11.05,10]icosa-2,5,11-triene-17,2'-oxolane]-4,7-dione.
| Compound Name | 3',13-dihydroxy-4',5',5',10,14,16-hexamethylspiro[18-oxapentacyclo[13.3.2.01,14.02,11.05,10]icosa-2,5,11-triene-17,2'-oxolane]-4,7-dione |
|---|---|
| PubChem CID | 76525141 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 3',13-dihydroxy-4',5',5',10,14,16-hexamethylspiro[18-oxapentacyclo[13.3.2.01,14.02,11.05,10]icosa-2,5,11-triene-17,2'-oxolane]-4,7-dione |
| SMILES | CC1C(O)C2(OC1(C)C)OC13CCC(C2C)C1(C)C(O)C=C1C3=CC(=O)C2=CC(=O)CCC21C |
| InChI | InChI=1S/C28H36O6/c1-14-17-8-10-27(34-28(14)23(32)15(2)24(3,4)33-28)19-12-21(30)20-11-16(29)7-9-25(20,5)18(19)13-22(31)26(17,27)6/h11-15,17,22-23,31-32H,7-10H2,1-6H3 |
| InChIKey | JSYVRIWAOTWBOZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |