C24H32ClNO3Si — CID 67894773
[[(S)-chloro-[(10R,13S,17R)-17-hydroxy-6,10,13-trimethyl-3-oxo-2,8,12,14,15,16-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl]-dimethylsilyl] cyanate (PubChem CID 67894773) has the molecular formula C24H32ClNO3Si and a molecular weight of 446.06 g/mol. Its IUPAC name is [[(S)-chloro-[(10R,13S,17R)-17-hydroxy-6,10,13-trimethyl-3-oxo-2,8,12,14,15,16-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl]-dimethylsilyl] cyanate.
| Compound Name | [[(S)-chloro-[(10R,13S,17R)-17-hydroxy-6,10,13-trimethyl-3-oxo-2,8,12,14,15,16-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl]-dimethylsilyl] cyanate |
|---|---|
| PubChem CID | 67894773 |
| Molecular Formula | C24H32ClNO3Si |
| Molecular Weight | 446.06 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [[(S)-chloro-[(10R,13S,17R)-17-hydroxy-6,10,13-trimethyl-3-oxo-2,8,12,14,15,16-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl]-dimethylsilyl] cyanate |
| SMILES | CC1=CC2C(=CC[C@@]3(C)C2CC[C@]3(O)[C@H](Cl)[Si](C)(C)OC#N)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C24H32ClNO3Si/c1-15-12-17-18(22(2)9-6-16(27)13-20(15)22)7-10-23(3)19(17)8-11-24(23,28)21(25)30(4,5)29-14-26/h7,12-13,17,19,21,28H,6,8-11H2,1-5H3/t17?,19?,21-,22-,23+,24+/m1/s1 |
| InChIKey | FCHNROHUOWWUEM-GYDIAKEBSA-N |
| XLogP | 5.18 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.06 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|