C42H35F2N5O2 — CID 76534169
methyl 3-[4-cyano-2-fluoro-5-(5-fluoro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)anilino]bicyclo[2.2.2]octane-2-carboxylate (PubChem CID 76534169) has the molecular formula C42H35F2N5O2 and a molecular weight of 679.77 g/mol. Its IUPAC name is methyl 3-[4-cyano-2-fluoro-5-(5-fluoro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)anilino]bicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | methyl 3-[4-cyano-2-fluoro-5-(5-fluoro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)anilino]bicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 76534169 |
| Molecular Formula | C42H35F2N5O2 |
| Molecular Weight | 679.77 g/mol |
| Exact Mass | 679.28 |
| IUPAC Name | methyl 3-[4-cyano-2-fluoro-5-(5-fluoro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)anilino]bicyclo[2.2.2]octane-2-carboxylate |
| SMILES | COC(=O)C1C2CCC(CC2)C1Nc1cc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ncc(F)cc23)c(C#N)cc1F |
| InChI | InChI=1S/C42H35F2N5O2/c1-51-41(50)37-26-17-19-27(20-18-26)38(37)47-36-23-33(28(24-45)21-35(36)44)39-34-22-32(43)25-46-40(34)49(48-39)42(29-11-5-2-6-12-29,30-13-7-3-8-14-30)31-15-9-4-10-16-31/h2-16,21-23,25-27,37-38,47H,17-20H2,1H3 |
| InChIKey | NENCNKVLUJQHBS-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.77 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|