C29H29F3N4O4 — CID 76538609
methyl N-[2-[[[1-ethoxyimino-1-[4-[4-(trifluoromethyl)phenoxy]phenyl]propan-2-ylidene]hydrazinylidene]methyl]phenyl]-N-ethylcarbamate (PubChem CID 76538609) has the molecular formula C29H29F3N4O4 and a molecular weight of 554.57 g/mol. Its IUPAC name is methyl N-[2-[[[1-ethoxyimino-1-[4-[4-(trifluoromethyl)phenoxy]phenyl]propan-2-ylidene]hydrazinylidene]methyl]phenyl]-N-ethylcarbamate.
| Compound Name | methyl N-[2-[[[1-ethoxyimino-1-[4-[4-(trifluoromethyl)phenoxy]phenyl]propan-2-ylidene]hydrazinylidene]methyl]phenyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 76538609 |
| Molecular Formula | C29H29F3N4O4 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | methyl N-[2-[[[1-ethoxyimino-1-[4-[4-(trifluoromethyl)phenoxy]phenyl]propan-2-ylidene]hydrazinylidene]methyl]phenyl]-N-ethylcarbamate |
| SMILES | CCON=C(C(C)=NN=Cc1ccccc1N(CC)C(=O)OC)c1ccc(Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H29F3N4O4/c1-5-36(28(37)38-4)26-10-8-7-9-22(26)19-33-34-20(3)27(35-39-6-2)21-11-15-24(16-12-21)40-25-17-13-23(14-18-25)29(30,31)32/h7-19H,5-6H2,1-4H3 |
| InChIKey | HQJNSORJLKKMFO-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 85.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|