C20H25N3O — CID 76542594
3-[4-[1-(methylamino)-2-pyrrolidin-1-ylethyl]phenyl]benzamide (PubChem CID 76542594) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-[4-[1-(methylamino)-2-pyrrolidin-1-ylethyl]phenyl]benzamide.
| Compound Name | 3-[4-[1-(methylamino)-2-pyrrolidin-1-ylethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 76542594 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 3-[4-[1-(methylamino)-2-pyrrolidin-1-ylethyl]phenyl]benzamide |
| SMILES | CNC(CN1CCCC1)c1ccc(-c2cccc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C20H25N3O/c1-22-19(14-23-11-2-3-12-23)16-9-7-15(8-10-16)17-5-4-6-18(13-17)20(21)24/h4-10,13,19,22H,2-3,11-12,14H2,1H3,(H2,21,24) |
| InChIKey | FVPJRWKBHPSQDS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |