C18H21Cl2N3 — CID 142725857
1-[4-(2,6-dichloro-4-pyridinyl)phenyl]-N-methyl-2-pyrrolidin-1-ylethanamine (PubChem CID 142725857) has the molecular formula C18H21Cl2N3 and a molecular weight of 350.29 g/mol. Its IUPAC name is 1-[4-(2,6-dichloro-4-pyridinyl)phenyl]-N-methyl-2-pyrrolidin-1-ylethanamine.
| Compound Name | 1-[4-(2,6-dichloro-4-pyridinyl)phenyl]-N-methyl-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 142725857 |
| Molecular Formula | C18H21Cl2N3 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1-[4-(2,6-dichloro-4-pyridinyl)phenyl]-N-methyl-2-pyrrolidin-1-ylethanamine |
| SMILES | CNC(CN1CCCC1)c1ccc(-c2cc(Cl)nc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H21Cl2N3/c1-21-16(12-23-8-2-3-9-23)14-6-4-13(5-7-14)15-10-17(19)22-18(20)11-15/h4-7,10-11,16,21H,2-3,8-9,12H2,1H3 |
| InChIKey | FYJZXZOFBQASMS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|