C34H32ClNO3S — CID 76543430
2-[1-[4-(2-acetylphenyl)-2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-1-sulfanylbutyl]cyclopropyl]acetic acid (PubChem CID 76543430) has the molecular formula C34H32ClNO3S and a molecular weight of 570.15 g/mol. Its IUPAC name is 2-[1-[4-(2-acetylphenyl)-2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-1-sulfanylbutyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[4-(2-acetylphenyl)-2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-1-sulfanylbutyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 76543430 |
| Molecular Formula | C34H32ClNO3S |
| Molecular Weight | 570.15 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 2-[1-[4-(2-acetylphenyl)-2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-1-sulfanylbutyl]cyclopropyl]acetic acid |
| SMILES | CC(=O)c1ccccc1CCC(c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1)C(S)C1(CC(=O)O)CC1 |
| InChI | InChI=1S/C34H32ClNO3S/c1-22(37)29-8-3-2-6-24(29)12-16-30(33(40)34(17-18-34)21-32(38)39)26-7-4-5-23(19-26)9-14-28-15-11-25-10-13-27(35)20-31(25)36-28/h2-11,13-15,19-20,30,33,40H,12,16-18,21H2,1H3,(H,38,39) |
| InChIKey | JADOMOMCQIEEBG-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.15 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|