C20H13F6NO4 — CID 76545365
2-[[4-[3-[3,5-bis(trifluoromethyl)phenoxy]prop-1-ynyl]phenyl]methylideneamino]oxyacetic acid (PubChem CID 76545365) has the molecular formula C20H13F6NO4 and a molecular weight of 445.32 g/mol. Its IUPAC name is 2-[[4-[3-[3,5-bis(trifluoromethyl)phenoxy]prop-1-ynyl]phenyl]methylideneamino]oxyacetic acid.
| Compound Name | 2-[[4-[3-[3,5-bis(trifluoromethyl)phenoxy]prop-1-ynyl]phenyl]methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 76545365 |
| Molecular Formula | C20H13F6NO4 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 2-[[4-[3-[3,5-bis(trifluoromethyl)phenoxy]prop-1-ynyl]phenyl]methylideneamino]oxyacetic acid |
| SMILES | O=C(O)CON=Cc1ccc(C#CCOc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H13F6NO4/c21-19(22,23)15-8-16(20(24,25)26)10-17(9-15)30-7-1-2-13-3-5-14(6-4-13)11-27-31-12-18(28)29/h3-6,8-11H,7,12H2,(H,28,29) |
| InChIKey | WNPUYRRMSWGACT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|