C7H2F12 — CID 76545605
1,1,1,2,2,5,5,6,6,7,7,7-dodecafluorohept-3-ene (PubChem CID 76545605) has the molecular formula C7H2F12 and a molecular weight of 314.07 g/mol. Its IUPAC name is 1,1,1,2,2,5,5,6,6,7,7,7-dodecafluorohept-3-ene.
| Compound Name | 1,1,1,2,2,5,5,6,6,7,7,7-dodecafluorohept-3-ene |
|---|---|
| PubChem CID | 76545605 |
| Molecular Formula | C7H2F12 |
| Molecular Weight | 314.07 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 1,1,1,2,2,5,5,6,6,7,7,7-dodecafluorohept-3-ene |
| SMILES | FC(F)(F)C(F)(F)C=CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H2F12/c8-3(9,5(12,13)7(17,18)19)1-2-4(10,11)6(14,15)16/h1-2H |
| InChIKey | YWSYXYXSEWRSMA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.07 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|