C12H9BrN2O2 — CID 7655795
4-bromo-N-(4-cyano-2,3-dihydrofuran-5-yl)benzamide (PubChem CID 7655795) has the molecular formula C12H9BrN2O2 and a molecular weight of 293.12 g/mol. Its IUPAC name is 4-bromo-N-(4-cyano-2,3-dihydrofuran-5-yl)benzamide.
| Compound Name | 4-bromo-N-(4-cyano-2,3-dihydrofuran-5-yl)benzamide |
|---|---|
| PubChem CID | 7655795 |
| Molecular Formula | C12H9BrN2O2 |
| Molecular Weight | 293.12 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 4-bromo-N-(4-cyano-2,3-dihydrofuran-5-yl)benzamide |
| SMILES | N#CC1=C(NC(=O)c2ccc(Br)cc2)OCC1 |
| InChI | InChI=1S/C12H9BrN2O2/c13-10-3-1-8(2-4-10)11(16)15-12-9(7-14)5-6-17-12/h1-4H,5-6H2,(H,15,16) |
| InChIKey | LGADZSOYPNPPPH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.12 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |