methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate

C14H12N2O4 — CID 7655862

IUPACmethyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate
SMILESCOC(=O)c1ccc(C(=O)NC2=C(C#N)CCO2)cc1
InChIInChI=1S/C14H12N2O4/c1-19-14(18)10-4-2-9(3-5-10)12(17)16-13-11(8-15)6-7-20-13/h2-5H,6-7H2,1H3,(H,16,17)
InChIKeyAGUBTIUHXFXFOH-UHFFFAOYSA-N
MW272.26 g/mol
LogP1.36
Rot. Bonds3

About methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate

methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate (PubChem CID 7655862) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate
PubChem CID7655862
Molecular FormulaC14H12N2O4
Molecular Weight272.26 g/mol
Exact Mass272.08
IUPAC Namemethyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate
SMILESCOC(=O)c1ccc(C(=O)NC2=C(C#N)CCO2)cc1
InChIInChI=1S/C14H12N2O4/c1-19-14(18)10-4-2-9(3-5-10)12(17)16-13-11(8-15)6-7-20-13/h2-5H,6-7H2,1H3,(H,16,17)
InChIKeyAGUBTIUHXFXFOH-UHFFFAOYSA-N
XLogP1.36
TPSA88.42 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.26
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate?
The IUPAC name of methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate (CID 7655862) is methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate.
What is the SMILES notation for methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate?
The canonical SMILES for methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate is COC(=O)c1ccc(C(=O)NC2=C(C#N)CCO2)cc1.
What is the InChIKey of methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate?
The InChIKey is AGUBTIUHXFXFOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O4/c1-19-14(18)10-4-2-9(3-5-10)12(17)16-13-11(8-15)6-7-20-13/h2-5H,6-7H2,1H3,(H,16,17).
What are the key properties of methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate?
methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate has a molecular weight of 272.26 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(4-cyano-2,3-dihydrofuran-5-yl)carbamoyl]benzoate is sourced from PubChem (CID 7655862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).