C13H12N2O4S — CID 7656005
N-(4-cyano-2,3-dihydrofuran-5-yl)-3-methylsulfonylbenzamide (PubChem CID 7656005) has the molecular formula C13H12N2O4S and a molecular weight of 292.32 g/mol. Its IUPAC name is N-(4-cyano-2,3-dihydrofuran-5-yl)-3-methylsulfonylbenzamide.
| Compound Name | N-(4-cyano-2,3-dihydrofuran-5-yl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 7656005 |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | N-(4-cyano-2,3-dihydrofuran-5-yl)-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)NC2=C(C#N)CCO2)c1 |
| InChI | InChI=1S/C13H12N2O4S/c1-20(17,18)11-4-2-3-9(7-11)12(16)15-13-10(8-14)5-6-19-13/h2-4,7H,5-6H2,1H3,(H,15,16) |
| InChIKey | LFWLFMJZCQJYKS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |