C24H29N2O2P — CID 76558150
1-[2-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]phosphanylphenyl]-N-pyrrol-1-ylmethanimine (PubChem CID 76558150) has the molecular formula C24H29N2O2P and a molecular weight of 408.48 g/mol. Its IUPAC name is 1-[2-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]phosphanylphenyl]-N-pyrrol-1-ylmethanimine.
| Compound Name | 1-[2-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]phosphanylphenyl]-N-pyrrol-1-ylmethanimine |
|---|---|
| PubChem CID | 76558150 |
| Molecular Formula | C24H29N2O2P |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-[2-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]phosphanylphenyl]-N-pyrrol-1-ylmethanimine |
| SMILES | COCOc1c(C)cc(C(C)(C)C)cc1Pc1ccccc1C=Nn1cccc1 |
| InChI | InChI=1S/C24H29N2O2P/c1-18-14-20(24(2,3)4)15-22(23(18)28-17-27-5)29-21-11-7-6-10-19(21)16-25-26-12-8-9-13-26/h6-16,29H,17H2,1-5H3 |
| InChIKey | GEWMJNNLMDKYQE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|