C22H25N2OP — CID 76558159
2-tert-butyl-4-methyl-6-[2-(pyrrol-1-yliminomethyl)phenyl]phosphanylphenol (PubChem CID 76558159) has the molecular formula C22H25N2OP and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-6-[2-(pyrrol-1-yliminomethyl)phenyl]phosphanylphenol.
| Compound Name | 2-tert-butyl-4-methyl-6-[2-(pyrrol-1-yliminomethyl)phenyl]phosphanylphenol |
|---|---|
| PubChem CID | 76558159 |
| Molecular Formula | C22H25N2OP |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-tert-butyl-4-methyl-6-[2-(pyrrol-1-yliminomethyl)phenyl]phosphanylphenol |
| SMILES | Cc1cc(Pc2ccccc2C=Nn2cccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H25N2OP/c1-16-13-18(22(2,3)4)21(25)20(14-16)26-19-10-6-5-9-17(19)15-23-24-11-7-8-12-24/h5-15,25-26H,1-4H3 |
| InChIKey | BRNCQHQBNQYAKX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|