C23H31N2OP — CID 149182518
2-tert-butyl-4-methyl-6-[2-[(Z)-piperidin-1-yliminomethyl]phenyl]phosphanylphenol (PubChem CID 149182518) has the molecular formula C23H31N2OP and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-6-[2-[(Z)-piperidin-1-yliminomethyl]phenyl]phosphanylphenol.
| Compound Name | 2-tert-butyl-4-methyl-6-[2-[(Z)-piperidin-1-yliminomethyl]phenyl]phosphanylphenol |
|---|---|
| PubChem CID | 149182518 |
| Molecular Formula | C23H31N2OP |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 2-tert-butyl-4-methyl-6-[2-[(Z)-piperidin-1-yliminomethyl]phenyl]phosphanylphenol |
| SMILES | Cc1cc(Pc2ccccc2/C=N\N2CCCCC2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H31N2OP/c1-17-14-19(23(2,3)4)22(26)21(15-17)27-20-11-7-6-10-18(20)16-24-25-12-8-5-9-13-25/h6-7,10-11,14-16,26-27H,5,8-9,12-13H2,1-4H3/b24-16- |
| InChIKey | XFBKPMZBECPIMX-JLPGSUDCSA-N |
| XLogP | 4.45 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|